C24H29NO6Si — CID 10789943
benzyl (2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxoisoindol-2-yl)oxypropanoate (PubChem CID 10789943) has the molecular formula C24H29NO6Si and a molecular weight of 455.58 g/mol. Its IUPAC name is benzyl (2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxoisoindol-2-yl)oxypropanoate.
| Compound Name | benzyl (2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxoisoindol-2-yl)oxypropanoate |
|---|---|
| PubChem CID | 10789943 |
| Molecular Formula | C24H29NO6Si |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | benzyl (2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxoisoindol-2-yl)oxypropanoate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](ON1C(=O)c2ccccc2C1=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H29NO6Si/c1-24(2,3)32(4,5)30-16-20(23(28)29-15-17-11-7-6-8-12-17)31-25-21(26)18-13-9-10-14-19(18)22(25)27/h6-14,20H,15-16H2,1-5H3/t20-/m1/s1 |
| InChIKey | FFJQDOMFPNXXTF-HXUWFJFHSA-N |
| XLogP | 4.35 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|