C26H37NO7Si — CID 42646421
[(2R,3S,4R)-1-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxy-2-(phenylmethoxycarbonylamino)pentan-3-yl] benzoate (PubChem CID 42646421) has the molecular formula C26H37NO7Si and a molecular weight of 503.67 g/mol. Its IUPAC name is [(2R,3S,4R)-1-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxy-2-(phenylmethoxycarbonylamino)pentan-3-yl] benzoate.
| Compound Name | [(2R,3S,4R)-1-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxy-2-(phenylmethoxycarbonylamino)pentan-3-yl] benzoate |
|---|---|
| PubChem CID | 42646421 |
| Molecular Formula | C26H37NO7Si |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | [(2R,3S,4R)-1-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxy-2-(phenylmethoxycarbonylamino)pentan-3-yl] benzoate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](NC(=O)OCc1ccccc1)[C@H](OC(=O)c1ccccc1)[C@H](O)CO |
| InChI | InChI=1S/C26H37NO7Si/c1-26(2,3)35(4,5)33-18-21(27-25(31)32-17-19-12-8-6-9-13-19)23(22(29)16-28)34-24(30)20-14-10-7-11-15-20/h6-15,21-23,28-29H,16-18H2,1-5H3,(H,27,31)/t21-,22-,23+/m1/s1 |
| InChIKey | LFMMGUFWDCFKNR-ZLNRFVROSA-N |
| XLogP | 3.88 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|