C21H33NO5Si — CID 10971559
[(3R,4R)-5-[tert-butyl(dimethyl)silyl]oxy-4-(phenylmethoxycarbonylamino)pent-1-en-3-yl] acetate (PubChem CID 10971559) has the molecular formula C21H33NO5Si and a molecular weight of 407.58 g/mol. Its IUPAC name is [(3R,4R)-5-[tert-butyl(dimethyl)silyl]oxy-4-(phenylmethoxycarbonylamino)pent-1-en-3-yl] acetate.
| Compound Name | [(3R,4R)-5-[tert-butyl(dimethyl)silyl]oxy-4-(phenylmethoxycarbonylamino)pent-1-en-3-yl] acetate |
|---|---|
| PubChem CID | 10971559 |
| Molecular Formula | C21H33NO5Si |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | [(3R,4R)-5-[tert-butyl(dimethyl)silyl]oxy-4-(phenylmethoxycarbonylamino)pent-1-en-3-yl] acetate |
| SMILES | C=C[C@@H](OC(C)=O)[C@@H](CO[Si](C)(C)C(C)(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H33NO5Si/c1-8-19(27-16(2)23)18(15-26-28(6,7)21(3,4)5)22-20(24)25-14-17-12-10-9-11-13-17/h8-13,18-19H,1,14-15H2,2-7H3,(H,22,24)/t18-,19-/m1/s1 |
| InChIKey | XCKWGYGRJDQAIQ-RTBURBONSA-N |
| XLogP | 4.42 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|