C26H35NO5Si — CID 70271977
benzyl N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-(2,3-dihydro-1,4-benzodioxin-6-yl)but-3-en-2-yl]carbamate (PubChem CID 70271977) has the molecular formula C26H35NO5Si and a molecular weight of 469.65 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-(2,3-dihydro-1,4-benzodioxin-6-yl)but-3-en-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-(2,3-dihydro-1,4-benzodioxin-6-yl)but-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 70271977 |
| Molecular Formula | C26H35NO5Si |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | benzyl N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-(2,3-dihydro-1,4-benzodioxin-6-yl)but-3-en-2-yl]carbamate |
| SMILES | C=C(c1ccc2c(c1)OCCO2)[C@@H](CO[Si](C)(C)C(C)(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H35NO5Si/c1-19(21-12-13-23-24(16-21)30-15-14-29-23)22(18-32-33(5,6)26(2,3)4)27-25(28)31-17-20-10-8-7-9-11-20/h7-13,16,22H,1,14-15,17-18H2,2-6H3,(H,27,28)/t22-/m1/s1 |
| InChIKey | PGCGAQDKXTXKEK-JOCHJYFZSA-N |
| XLogP | 5.79 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|