C23H40N2O5Si — CID 59684355
tert-butyl N-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-[(2S)-2-(phenylmethoxycarbonylamino)propyl]carbamate (PubChem CID 59684355) has the molecular formula C23H40N2O5Si and a molecular weight of 452.67 g/mol. Its IUPAC name is tert-butyl N-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-[(2S)-2-(phenylmethoxycarbonylamino)propyl]carbamate.
| Compound Name | tert-butyl N-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-[(2S)-2-(phenylmethoxycarbonylamino)propyl]carbamate |
|---|---|
| PubChem CID | 59684355 |
| Molecular Formula | C23H40N2O5Si |
| Molecular Weight | 452.67 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | tert-butyl N-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-[(2S)-2-(phenylmethoxycarbonylamino)propyl]carbamate |
| SMILES | C[C@@H](CN(CO[Si](C)(C)C(C)(C)C)C(=O)OC(C)(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H40N2O5Si/c1-18(24-20(26)28-16-19-13-11-10-12-14-19)15-25(21(27)30-22(2,3)4)17-29-31(8,9)23(5,6)7/h10-14,18H,15-17H2,1-9H3,(H,24,26)/t18-/m0/s1 |
| InChIKey | ANORVVTXSWIASA-SFHVURJKSA-N |
| XLogP | 5.52 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.67 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|