C26H32N2O8 — CID 170214413
benzyl (2S)-3-[acetyloxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 170214413) has the molecular formula C26H32N2O8 and a molecular weight of 500.55 g/mol. Its IUPAC name is benzyl (2S)-3-[acetyloxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | benzyl (2S)-3-[acetyloxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 170214413 |
| Molecular Formula | C26H32N2O8 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | benzyl (2S)-3-[acetyloxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | CC(=O)OCN(C[C@H](NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H32N2O8/c1-19(29)35-18-28(25(32)36-26(2,3)4)15-22(23(30)33-16-20-11-7-5-8-12-20)27-24(31)34-17-21-13-9-6-10-14-21/h5-14,22H,15-18H2,1-4H3,(H,27,31)/t22-/m0/s1 |
| InChIKey | LRBRSPHRFVZULF-QFIPXVFZSA-N |
| XLogP | 3.78 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|