C20H33NO5Si — CID 11338426
benzyl N-[(2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-[(2S)-oxiran-2-yl]butan-2-yl]carbamate (PubChem CID 11338426) has the molecular formula C20H33NO5Si and a molecular weight of 395.57 g/mol. Its IUPAC name is benzyl N-[(2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-[(2S)-oxiran-2-yl]butan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-[(2S)-oxiran-2-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 11338426 |
| Molecular Formula | C20H33NO5Si |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | benzyl N-[(2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4-[(2S)-oxiran-2-yl]butan-2-yl]carbamate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](NC(=O)OCc1ccccc1)[C@@H](O)C[C@H]1CO1 |
| InChI | InChI=1S/C20H33NO5Si/c1-20(2,3)27(4,5)26-14-17(18(22)11-16-13-24-16)21-19(23)25-12-15-9-7-6-8-10-15/h6-10,16-18,22H,11-14H2,1-5H3,(H,21,23)/t16-,17-,18-/m0/s1 |
| InChIKey | ROWMNUWFMVQHMY-BZSNNMDCSA-N |
| XLogP | 3.45 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|