C26H33NO5Si — CID 67694959
benzyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxoisoindol-2-yl)-2-methylbutanoate (PubChem CID 67694959) has the molecular formula C26H33NO5Si and a molecular weight of 467.64 g/mol. Its IUPAC name is benzyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxoisoindol-2-yl)-2-methylbutanoate.
| Compound Name | benzyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxoisoindol-2-yl)-2-methylbutanoate |
|---|---|
| PubChem CID | 67694959 |
| Molecular Formula | C26H33NO5Si |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | benzyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxoisoindol-2-yl)-2-methylbutanoate |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@](C)(C(=O)OCc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H33NO5Si/c1-18(32-33(6,7)25(2,3)4)26(5,24(30)31-17-19-13-9-8-10-14-19)27-22(28)20-15-11-12-16-21(20)23(27)29/h8-16,18H,17H2,1-7H3/t18-,26+/m1/s1 |
| InChIKey | FPKRMPWMSIPPOK-DWXRJYCRSA-N |
| XLogP | 5.20 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|