C20H32FNO3Si — CID 178035038
benzyl 3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-fluoropyrrolidine-1-carboxylate (PubChem CID 178035038) has the molecular formula C20H32FNO3Si and a molecular weight of 381.56 g/mol. Its IUPAC name is benzyl 3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-fluoropyrrolidine-1-carboxylate.
| Compound Name | benzyl 3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-fluoropyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 178035038 |
| Molecular Formula | C20H32FNO3Si |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | benzyl 3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-fluoropyrrolidine-1-carboxylate |
| SMILES | CC(O[Si](C)(C)C(C)(C)C)C1(F)CCN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C20H32FNO3Si/c1-16(25-26(5,6)19(2,3)4)20(21)12-13-22(15-20)18(23)24-14-17-10-8-7-9-11-17/h7-11,16H,12-15H2,1-6H3 |
| InChIKey | LVPJEBARJIRSNC-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|