C21H31F4NO3Si — CID 67401396
benzyl 4-fluoro-4-(2,2,2-trifluoro-1-triethylsilyloxyethyl)piperidine-1-carboxylate (PubChem CID 67401396) has the molecular formula C21H31F4NO3Si and a molecular weight of 449.56 g/mol. Its IUPAC name is benzyl 4-fluoro-4-(2,2,2-trifluoro-1-triethylsilyloxyethyl)piperidine-1-carboxylate.
| Compound Name | benzyl 4-fluoro-4-(2,2,2-trifluoro-1-triethylsilyloxyethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67401396 |
| Molecular Formula | C21H31F4NO3Si |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | benzyl 4-fluoro-4-(2,2,2-trifluoro-1-triethylsilyloxyethyl)piperidine-1-carboxylate |
| SMILES | CC[Si](CC)(CC)OC(C(F)(F)F)C1(F)CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H31F4NO3Si/c1-4-30(5-2,6-3)29-18(21(23,24)25)20(22)12-14-26(15-13-20)19(27)28-16-17-10-8-7-9-11-17/h7-11,18H,4-6,12-16H2,1-3H3 |
| InChIKey | XHZLZRNNMSOIAT-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|