About Benzyl 4-fluoro-4-(2,2,2-trifluoro-1-triethylsilyloxyethyl)piperidine-1-carboxylate
Benzyl 4-fluoro-4-(2,2,2-trifluoro-1-triethylsilyloxyethyl)piperidine-1-carboxylate (PubChem CID 67401396) has the molecular formula C21H31F4NO3Si
and a molecular weight of 449.60 g/mol. Its IUPAC name is benzyl 4-fluoro-4-(2,2,2-trifluoro-1-triethylsilyloxyethyl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | Benzyl 4-fluoro-4-(2,2,2-trifluoro-1-triethylsilyloxyethyl)piperidine-1-carboxylate |
| PubChem CID | 67401396 |
| Molecular Formula | C21H31F4NO3Si |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | benzyl 4-fluoro-4-(2,2,2-trifluoro-1-triethylsilyloxyethyl)piperidine-1-carboxylate |
| SMILES | CC[Si](CC)(CC)OC(C1(CCN(CC1)C(=O)OCC2=CC=CC=C2)F)C(F)(F)F |
| InChI | InChI=1S/C21H31F4NO3Si/c1-4-30(5-2,6-3)29-18(21(23,24)25)20(22)12-14-26(15-13-20)19(27)28-16-17-10-8-7-9-11-17/h7-11,18H,4-6,12-16H2,1-3H3 |
| InChIKey | XHZLZRNNMSOIAT-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 38.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | 535 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Benzyl 4-fluoro-4-(2,2,2-trifluoro-1-triethylsilyloxyethyl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Benzyl 4-fluoro-4-(2,2,2-trifluoro-1-triethylsilyloxyethyl)piperidine-1-carboxylate?
The IUPAC name of Benzyl 4-fluoro-4-(2,2,2-trifluoro-1-triethylsilyloxyethyl)piperidine-1-carboxylate (CID 67401396) is benzyl 4-fluoro-4-(2,2,2-trifluoro-1-triethylsilyloxyethyl)piperidine-1-carboxylate.
What is the SMILES notation for Benzyl 4-fluoro-4-(2,2,2-trifluoro-1-triethylsilyloxyethyl)piperidine-1-carboxylate?
The canonical SMILES for Benzyl 4-fluoro-4-(2,2,2-trifluoro-1-triethylsilyloxyethyl)piperidine-1-carboxylate is CC[Si](CC)(CC)OC(C1(CCN(CC1)C(=O)OCC2=CC=CC=C2)F)C(F)(F)F.
What is the InChIKey of Benzyl 4-fluoro-4-(2,2,2-trifluoro-1-triethylsilyloxyethyl)piperidine-1-carboxylate?
The InChIKey is XHZLZRNNMSOIAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31F4NO3Si/c1-4-30(5-2,6-3)29-18(21(23,24)25)20(22)12-14-26(15-13-20)19(27)28-16-17-10-8-7-9-11-17/h7-11,18H,4-6,12-16H2,1-3H3.
What are the key properties of Benzyl 4-fluoro-4-(2,2,2-trifluoro-1-triethylsilyloxyethyl)piperidine-1-carboxylate?
Benzyl 4-fluoro-4-(2,2,2-trifluoro-1-triethylsilyloxyethyl)piperidine-1-carboxylate has a molecular weight of 449.60 g/mol, XLogP of not available, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for Benzyl 4-fluoro-4-(2,2,2-trifluoro-1-triethylsilyloxyethyl)piperidine-1-carboxylate is sourced from PubChem (CID 67401396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).