C21H32F3NO3Si — CID 67401817
benzyl 4-(2,2,2-trifluoro-1-triethylsilyloxyethyl)piperidine-1-carboxylate (PubChem CID 67401817) has the molecular formula C21H32F3NO3Si and a molecular weight of 431.57 g/mol. Its IUPAC name is benzyl 4-(2,2,2-trifluoro-1-triethylsilyloxyethyl)piperidine-1-carboxylate.
| Compound Name | benzyl 4-(2,2,2-trifluoro-1-triethylsilyloxyethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67401817 |
| Molecular Formula | C21H32F3NO3Si |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | benzyl 4-(2,2,2-trifluoro-1-triethylsilyloxyethyl)piperidine-1-carboxylate |
| SMILES | CC[Si](CC)(CC)OC(C1CCN(C(=O)OCc2ccccc2)CC1)C(F)(F)F |
| InChI | InChI=1S/C21H32F3NO3Si/c1-4-29(5-2,6-3)28-19(21(22,23)24)18-12-14-25(15-13-18)20(26)27-16-17-10-8-7-9-11-17/h7-11,18-19H,4-6,12-16H2,1-3H3 |
| InChIKey | MQMJGUKSQFHEKW-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|