C20H27NO5 — CID 67438602
benzyl 4-(1-ethoxy-1,4-dioxopentan-2-yl)piperidine-1-carboxylate (PubChem CID 67438602) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is benzyl 4-(1-ethoxy-1,4-dioxopentan-2-yl)piperidine-1-carboxylate.
| Compound Name | benzyl 4-(1-ethoxy-1,4-dioxopentan-2-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67438602 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | benzyl 4-(1-ethoxy-1,4-dioxopentan-2-yl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)C(CC(C)=O)C1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H27NO5/c1-3-25-19(23)18(13-15(2)22)17-9-11-21(12-10-17)20(24)26-14-16-7-5-4-6-8-16/h4-8,17-18H,3,9-14H2,1-2H3 |
| InChIKey | SDEWWAQLOCNCSG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |