C19H29NO3 — CID 70855943
benzyl 4-(5-hydroxy-3-methylpentan-2-yl)piperidine-1-carboxylate (PubChem CID 70855943) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is benzyl 4-(5-hydroxy-3-methylpentan-2-yl)piperidine-1-carboxylate.
| Compound Name | benzyl 4-(5-hydroxy-3-methylpentan-2-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 70855943 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | benzyl 4-(5-hydroxy-3-methylpentan-2-yl)piperidine-1-carboxylate |
| SMILES | CC(CCO)C(C)C1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C19H29NO3/c1-15(10-13-21)16(2)18-8-11-20(12-9-18)19(22)23-14-17-6-4-3-5-7-17/h3-7,15-16,18,21H,8-14H2,1-2H3 |
| InChIKey | KIXPUHVLULEFEY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |