C17H24N2O4 — CID 170885033
benzyl 3-(2-amino-3-ethoxy-3-oxopropyl)pyrrolidine-1-carboxylate (PubChem CID 170885033) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is benzyl 3-(2-amino-3-ethoxy-3-oxopropyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl 3-(2-amino-3-ethoxy-3-oxopropyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 170885033 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | benzyl 3-(2-amino-3-ethoxy-3-oxopropyl)pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)C(N)CC1CCN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C17H24N2O4/c1-2-22-16(20)15(18)10-14-8-9-19(11-14)17(21)23-12-13-6-4-3-5-7-13/h3-7,14-15H,2,8-12,18H2,1H3 |
| InChIKey | HPCZJOPJDSMWIA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |