C26H36N2O4Si — CID 11826773
benzyl N-[(2S,3S)-1-benzyl-2-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-3-yl]carbamate (PubChem CID 11826773) has the molecular formula C26H36N2O4Si and a molecular weight of 468.67 g/mol. Its IUPAC name is benzyl N-[(2S,3S)-1-benzyl-2-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-3-yl]carbamate.
| Compound Name | benzyl N-[(2S,3S)-1-benzyl-2-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-3-yl]carbamate |
|---|---|
| PubChem CID | 11826773 |
| Molecular Formula | C26H36N2O4Si |
| Molecular Weight | 468.67 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | benzyl N-[(2S,3S)-1-benzyl-2-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-3-yl]carbamate |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1[C@H](NC(=O)OCc2ccccc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C26H36N2O4Si/c1-19(32-33(5,6)26(2,3)4)23-22(24(29)28(23)17-20-13-9-7-10-14-20)27-25(30)31-18-21-15-11-8-12-16-21/h7-16,19,22-23H,17-18H2,1-6H3,(H,27,30)/t19-,22-,23+/m0/s1 |
| InChIKey | YNEBHSZQLGXHIK-AJSBUHFISA-N |
| XLogP | 5.10 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.67 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|