C24H37NO6SSi — CID 56610739
benzyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-methylsulfonyl-4-oxoazetidin-1-yl]-3-methylbut-2-enoate (PubChem CID 56610739) has the molecular formula C24H37NO6SSi and a molecular weight of 495.71 g/mol. Its IUPAC name is benzyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-methylsulfonyl-4-oxoazetidin-1-yl]-3-methylbut-2-enoate.
| Compound Name | benzyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-methylsulfonyl-4-oxoazetidin-1-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 56610739 |
| Molecular Formula | C24H37NO6SSi |
| Molecular Weight | 495.71 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | benzyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-methylsulfonyl-4-oxoazetidin-1-yl]-3-methylbut-2-enoate |
| SMILES | CC(C)=C(C(=O)OCc1ccccc1)N1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]1S(C)(=O)=O |
| InChI | InChI=1S/C24H37NO6SSi/c1-16(2)20(23(27)30-15-18-13-11-10-12-14-18)25-21(26)19(22(25)32(7,28)29)17(3)31-33(8,9)24(4,5)6/h10-14,17,19,22H,15H2,1-9H3/t17-,19+,22-/m1/s1 |
| InChIKey | JQLGXJFMPVHLEP-ZWCUEREDSA-N |
| XLogP | 4.26 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.71 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|