C15H16BrNO6S — CID 22847863
(2R,3S)-3-bromo-1-(3-methyl-1-oxo-1-phenylmethoxybut-2-en-2-yl)-4-oxoazetidine-2-sulfonic acid (PubChem CID 22847863) has the molecular formula C15H16BrNO6S and a molecular weight of 418.27 g/mol. Its IUPAC name is (2R,3S)-3-bromo-1-(3-methyl-1-oxo-1-phenylmethoxybut-2-en-2-yl)-4-oxoazetidine-2-sulfonic acid.
| Compound Name | (2R,3S)-3-bromo-1-(3-methyl-1-oxo-1-phenylmethoxybut-2-en-2-yl)-4-oxoazetidine-2-sulfonic acid |
|---|---|
| PubChem CID | 22847863 |
| Molecular Formula | C15H16BrNO6S |
| Molecular Weight | 418.27 g/mol |
| Exact Mass | 416.99 |
| IUPAC Name | (2R,3S)-3-bromo-1-(3-methyl-1-oxo-1-phenylmethoxybut-2-en-2-yl)-4-oxoazetidine-2-sulfonic acid |
| SMILES | CC(C)=C(C(=O)OCc1ccccc1)N1C(=O)[C@H](Br)[C@H]1S(=O)(=O)O |
| InChI | InChI=1S/C15H16BrNO6S/c1-9(2)12(15(19)23-8-10-6-4-3-5-7-10)17-13(18)11(16)14(17)24(20,21)22/h3-7,11,14H,8H2,1-2H3,(H,20,21,22)/t11-,14+/m0/s1 |
| InChIKey | VACIKKBGGUGWKB-SMDDNHRTSA-N |
| XLogP | 1.84 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|