C20H22BrNO6S — CID 67697180
(4-methoxyphenyl)methyl 2-[(2R,3S)-3-bromo-2-(3-methoxy-3-oxoprop-1-enyl)sulfanyl-4-oxoazetidin-1-yl]-3-methylbut-2-enoate (PubChem CID 67697180) has the molecular formula C20H22BrNO6S and a molecular weight of 484.37 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 2-[(2R,3S)-3-bromo-2-(3-methoxy-3-oxoprop-1-enyl)sulfanyl-4-oxoazetidin-1-yl]-3-methylbut-2-enoate.
| Compound Name | (4-methoxyphenyl)methyl 2-[(2R,3S)-3-bromo-2-(3-methoxy-3-oxoprop-1-enyl)sulfanyl-4-oxoazetidin-1-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 67697180 |
| Molecular Formula | C20H22BrNO6S |
| Molecular Weight | 484.37 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | (4-methoxyphenyl)methyl 2-[(2R,3S)-3-bromo-2-(3-methoxy-3-oxoprop-1-enyl)sulfanyl-4-oxoazetidin-1-yl]-3-methylbut-2-enoate |
| SMILES | COC(=O)C=CS[C@@H]1[C@@H](Br)C(=O)N1C(C(=O)OCc1ccc(OC)cc1)=C(C)C |
| InChI | InChI=1S/C20H22BrNO6S/c1-12(2)17(20(25)28-11-13-5-7-14(26-3)8-6-13)22-18(24)16(21)19(22)29-10-9-15(23)27-4/h5-10,16,19H,11H2,1-4H3/t16-,19+/m0/s1 |
| InChIKey | UXNLFSSUQGYUFQ-QFBILLFUSA-N |
| XLogP | 3.38 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|