C37H33BrN2O8S — CID 88823495
(4-methoxyphenyl)methyl (E)-2-[3-[[2-(2-benzhydryloxyphenyl)acetyl]amino]-2-formylsulfanyl-4-oxoazetidin-1-yl]-4-bromo-3-hydroxybut-2-enoate (PubChem CID 88823495) has the molecular formula C37H33BrN2O8S and a molecular weight of 745.65 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (E)-2-[3-[[2-(2-benzhydryloxyphenyl)acetyl]amino]-2-formylsulfanyl-4-oxoazetidin-1-yl]-4-bromo-3-hydroxybut-2-enoate.
| Compound Name | (4-methoxyphenyl)methyl (E)-2-[3-[[2-(2-benzhydryloxyphenyl)acetyl]amino]-2-formylsulfanyl-4-oxoazetidin-1-yl]-4-bromo-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 88823495 |
| Molecular Formula | C37H33BrN2O8S |
| Molecular Weight | 745.65 g/mol |
| Exact Mass | 744.11 |
| IUPAC Name | (4-methoxyphenyl)methyl (E)-2-[3-[[2-(2-benzhydryloxyphenyl)acetyl]amino]-2-formylsulfanyl-4-oxoazetidin-1-yl]-4-bromo-3-hydroxybut-2-enoate |
| SMILES | COc1ccc(COC(=O)/C(=C(\O)CBr)N2C(=O)C(NC(=O)Cc3ccccc3OC(c3ccccc3)c3ccccc3)C2SC=O)cc1 |
| InChI | InChI=1S/C37H33BrN2O8S/c1-46-28-18-16-24(17-19-28)22-47-37(45)33(29(42)21-38)40-35(44)32(36(40)49-23-41)39-31(43)20-27-14-8-9-15-30(27)48-34(25-10-4-2-5-11-25)26-12-6-3-7-13-26/h2-19,23,32,34,36,42H,20-22H2,1H3,(H,39,43)/b33-29+ |
| InChIKey | JOQCSJRWHCIZFA-XPXRSFDGSA-N |
| XLogP | 5.89 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.65 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|