C24H23BrN2O7S — CID 173455665
(4-methoxyphenyl)methyl 2-[3-(N-acetylanilino)-2-formylsulfanyl-4-oxoazetidin-1-yl]-4-bromo-3-hydroxybut-2-enoate (PubChem CID 173455665) has the molecular formula C24H23BrN2O7S and a molecular weight of 563.43 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 2-[3-(N-acetylanilino)-2-formylsulfanyl-4-oxoazetidin-1-yl]-4-bromo-3-hydroxybut-2-enoate.
| Compound Name | (4-methoxyphenyl)methyl 2-[3-(N-acetylanilino)-2-formylsulfanyl-4-oxoazetidin-1-yl]-4-bromo-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 173455665 |
| Molecular Formula | C24H23BrN2O7S |
| Molecular Weight | 563.43 g/mol |
| Exact Mass | 562.04 |
| IUPAC Name | (4-methoxyphenyl)methyl 2-[3-(N-acetylanilino)-2-formylsulfanyl-4-oxoazetidin-1-yl]-4-bromo-3-hydroxybut-2-enoate |
| SMILES | COc1ccc(COC(=O)C(=C(O)CBr)N2C(=O)C(N(C(C)=O)c3ccccc3)C2SC=O)cc1 |
| InChI | InChI=1S/C24H23BrN2O7S/c1-15(29)26(17-6-4-3-5-7-17)21-22(31)27(23(21)35-14-28)20(19(30)12-25)24(32)34-13-16-8-10-18(33-2)11-9-16/h3-11,14,21,23,30H,12-13H2,1-2H3 |
| InChIKey | MRKYHKWNUUXSPW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|