C18H16BrCl3N2O7S — CID 88793870
benzyl (E)-4-bromo-2-[2-formylsulfanyl-4-oxo-3-(2,2,2-trichloroethoxycarbonylamino)azetidin-1-yl]-3-hydroxybut-2-enoate (PubChem CID 88793870) has the molecular formula C18H16BrCl3N2O7S and a molecular weight of 590.66 g/mol. Its IUPAC name is benzyl (E)-4-bromo-2-[2-formylsulfanyl-4-oxo-3-(2,2,2-trichloroethoxycarbonylamino)azetidin-1-yl]-3-hydroxybut-2-enoate.
| Compound Name | benzyl (E)-4-bromo-2-[2-formylsulfanyl-4-oxo-3-(2,2,2-trichloroethoxycarbonylamino)azetidin-1-yl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 88793870 |
| Molecular Formula | C18H16BrCl3N2O7S |
| Molecular Weight | 590.66 g/mol |
| Exact Mass | 587.89 |
| IUPAC Name | benzyl (E)-4-bromo-2-[2-formylsulfanyl-4-oxo-3-(2,2,2-trichloroethoxycarbonylamino)azetidin-1-yl]-3-hydroxybut-2-enoate |
| SMILES | O=CSC1C(NC(=O)OCC(Cl)(Cl)Cl)C(=O)N1/C(C(=O)OCc1ccccc1)=C(/O)CBr |
| InChI | InChI=1S/C18H16BrCl3N2O7S/c19-6-11(26)13(16(28)30-7-10-4-2-1-3-5-10)24-14(27)12(15(24)32-9-25)23-17(29)31-8-18(20,21)22/h1-5,9,12,15,26H,6-8H2,(H,23,29)/b13-11+ |
| InChIKey | UMROVIJVXKFQJL-ACCUITESSA-N |
| XLogP | 3.45 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.66 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|