C14H16Cl3NO3 — CID 168926737
2,2,2-trichloroethyl N-(3-phenylmethoxycyclobutyl)carbamate (PubChem CID 168926737) has the molecular formula C14H16Cl3NO3 and a molecular weight of 352.65 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-(3-phenylmethoxycyclobutyl)carbamate.
| Compound Name | 2,2,2-trichloroethyl N-(3-phenylmethoxycyclobutyl)carbamate |
|---|---|
| PubChem CID | 168926737 |
| Molecular Formula | C14H16Cl3NO3 |
| Molecular Weight | 352.65 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 2,2,2-trichloroethyl N-(3-phenylmethoxycyclobutyl)carbamate |
| SMILES | O=C(NC1CC(OCc2ccccc2)C1)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H16Cl3NO3/c15-14(16,17)9-21-13(19)18-11-6-12(7-11)20-8-10-4-2-1-3-5-10/h1-5,11-12H,6-9H2,(H,18,19) |
| InChIKey | YFASJVOXTWILSG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.65 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|