C16H15BrN2O6S — CID 131710652
4-bromo-2-[2-formylsulfanyl-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-3-hydroxybut-2-enoic acid (PubChem CID 131710652) has the molecular formula C16H15BrN2O6S and a molecular weight of 443.28 g/mol. Its IUPAC name is 4-bromo-2-[2-formylsulfanyl-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-3-hydroxybut-2-enoic acid.
| Compound Name | 4-bromo-2-[2-formylsulfanyl-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-3-hydroxybut-2-enoic acid |
|---|---|
| PubChem CID | 131710652 |
| Molecular Formula | C16H15BrN2O6S |
| Molecular Weight | 443.28 g/mol |
| Exact Mass | 441.98 |
| IUPAC Name | 4-bromo-2-[2-formylsulfanyl-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-3-hydroxybut-2-enoic acid |
| SMILES | O=CSC1C(NC(=O)Cc2ccccc2)C(=O)N1C(C(=O)O)=C(O)CBr |
| InChI | InChI=1S/C16H15BrN2O6S/c17-7-10(21)13(16(24)25)19-14(23)12(15(19)26-8-20)18-11(22)6-9-4-2-1-3-5-9/h1-5,8,12,15,21H,6-7H2,(H,18,22)(H,24,25) |
| InChIKey | SBWNNVWYJSNNAW-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|