C25H20BrF3N2O7S — CID 88794412
phenacyl (E)-4-bromo-2-[2-formylsulfanyl-4-oxo-3-[[2-[3-(trifluoromethyl)phenyl]acetyl]amino]azetidin-1-yl]-3-hydroxybut-2-enoate (PubChem CID 88794412) has the molecular formula C25H20BrF3N2O7S and a molecular weight of 629.41 g/mol. Its IUPAC name is phenacyl (E)-4-bromo-2-[2-formylsulfanyl-4-oxo-3-[[2-[3-(trifluoromethyl)phenyl]acetyl]amino]azetidin-1-yl]-3-hydroxybut-2-enoate.
| Compound Name | phenacyl (E)-4-bromo-2-[2-formylsulfanyl-4-oxo-3-[[2-[3-(trifluoromethyl)phenyl]acetyl]amino]azetidin-1-yl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 88794412 |
| Molecular Formula | C25H20BrF3N2O7S |
| Molecular Weight | 629.41 g/mol |
| Exact Mass | 628.01 |
| IUPAC Name | phenacyl (E)-4-bromo-2-[2-formylsulfanyl-4-oxo-3-[[2-[3-(trifluoromethyl)phenyl]acetyl]amino]azetidin-1-yl]-3-hydroxybut-2-enoate |
| SMILES | O=CSC1C(NC(=O)Cc2cccc(C(F)(F)F)c2)C(=O)N1/C(C(=O)OCC(=O)c1ccccc1)=C(/O)CBr |
| InChI | InChI=1S/C25H20BrF3N2O7S/c26-11-17(33)21(24(37)38-12-18(34)15-6-2-1-3-7-15)31-22(36)20(23(31)39-13-32)30-19(35)10-14-5-4-8-16(9-14)25(27,28)29/h1-9,13,20,23,33H,10-12H2,(H,30,35)/b21-17+ |
| InChIKey | OECJVDLGBBPVIG-HEHNFIMWSA-N |
| XLogP | 3.41 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|