C26H35N3O6SSi — CID 54423290
trimethylsilyl 2-[2-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)sulfanyl-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-3-methylbut-2-enoate (PubChem CID 54423290) has the molecular formula C26H35N3O6SSi and a molecular weight of 545.73 g/mol. Its IUPAC name is trimethylsilyl 2-[2-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)sulfanyl-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-3-methylbut-2-enoate.
| Compound Name | trimethylsilyl 2-[2-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)sulfanyl-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 54423290 |
| Molecular Formula | C26H35N3O6SSi |
| Molecular Weight | 545.73 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | trimethylsilyl 2-[2-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)sulfanyl-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-3-methylbut-2-enoate |
| SMILES | CC(C)=C(C(=O)O[Si](C)(C)C)N1C(=O)C(NC(=O)Cc2ccccc2)C1SN1C(=O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C26H35N3O6SSi/c1-16(2)22(25(34)35-37(5,6)7)28-23(33)21(27-18(30)13-17-11-9-8-10-12-17)24(28)36-29-19(31)14-26(3,4)15-20(29)32/h8-12,21,24H,13-15H2,1-7H3,(H,27,30) |
| InChIKey | WCHQGQIXQRBLOS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.73 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|