C19H23BrN2O5SSi — CID 22809790
trimethylsilyl (6S)-3-(bromomethyl)-5,8-dioxo-7-[(2-phenylacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 22809790) has the molecular formula C19H23BrN2O5SSi and a molecular weight of 499.46 g/mol. Its IUPAC name is trimethylsilyl (6S)-3-(bromomethyl)-5,8-dioxo-7-[(2-phenylacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | trimethylsilyl (6S)-3-(bromomethyl)-5,8-dioxo-7-[(2-phenylacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 22809790 |
| Molecular Formula | C19H23BrN2O5SSi |
| Molecular Weight | 499.46 g/mol |
| Exact Mass | 498.03 |
| IUPAC Name | trimethylsilyl (6S)-3-(bromomethyl)-5,8-dioxo-7-[(2-phenylacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | C[Si](C)(C)OC(=O)C1=C(CBr)CS(=O)[C@H]2C(NC(=O)Cc3ccccc3)C(=O)N12 |
| InChI | InChI=1S/C19H23BrN2O5SSi/c1-29(2,3)27-19(25)16-13(10-20)11-28(26)18-15(17(24)22(16)18)21-14(23)9-12-7-5-4-6-8-12/h4-8,15,18H,9-11H2,1-3H3,(H,21,23)/t15?,18-,28?/m0/s1 |
| InChIKey | SDXAAZSIHFTITI-PFRJXMHISA-N |
| XLogP | 1.67 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.46 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|