C19H22Br2N2O4SSi — CID 67791567
trimethylsilyl (6R,7R)-4-bromo-3-(bromomethyl)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 67791567) has the molecular formula C19H22Br2N2O4SSi and a molecular weight of 562.36 g/mol. Its IUPAC name is trimethylsilyl (6R,7R)-4-bromo-3-(bromomethyl)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | trimethylsilyl (6R,7R)-4-bromo-3-(bromomethyl)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 67791567 |
| Molecular Formula | C19H22Br2N2O4SSi |
| Molecular Weight | 562.36 g/mol |
| Exact Mass | 559.94 |
| IUPAC Name | trimethylsilyl (6R,7R)-4-bromo-3-(bromomethyl)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | C[Si](C)(C)OC(=O)C1=C(CBr)C(Br)S[C@@H]2[C@H](NC(=O)Cc3ccccc3)C(=O)N12 |
| InChI | InChI=1S/C19H22Br2N2O4SSi/c1-29(2,3)27-19(26)15-12(10-20)16(21)28-18-14(17(25)23(15)18)22-13(24)9-11-7-5-4-6-8-11/h4-8,14,16,18H,9-10H2,1-3H3,(H,22,24)/t14-,16?,18-/m1/s1 |
| InChIKey | ZRNAKCVNCJWFPY-OXPKRCOGSA-N |
| XLogP | 3.38 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|