C25H34N4O6SSi — CID 173438365
N-[1-(2-methyl-4-oxo-1-trimethylsilyloxybut-2-enyl)-2-oxo-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)sulfanylazetidin-3-yl]-2-phenylacetamide (PubChem CID 173438365) has the molecular formula C25H34N4O6SSi and a molecular weight of 546.72 g/mol. Its IUPAC name is N-[1-(2-methyl-4-oxo-1-trimethylsilyloxybut-2-enyl)-2-oxo-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)sulfanylazetidin-3-yl]-2-phenylacetamide.
| Compound Name | N-[1-(2-methyl-4-oxo-1-trimethylsilyloxybut-2-enyl)-2-oxo-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)sulfanylazetidin-3-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 173438365 |
| Molecular Formula | C25H34N4O6SSi |
| Molecular Weight | 546.72 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | N-[1-(2-methyl-4-oxo-1-trimethylsilyloxybut-2-enyl)-2-oxo-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)sulfanylazetidin-3-yl]-2-phenylacetamide |
| SMILES | CC(=CC=O)C(O[Si](C)(C)C)N1C(=O)C(NC(=O)Cc2ccccc2)C1SN1C(=O)N(C)C(C)(C)C1=O |
| InChI | InChI=1S/C25H34N4O6SSi/c1-16(13-14-30)21(35-37(5,6)7)28-20(32)19(26-18(31)15-17-11-9-8-10-12-17)22(28)36-29-23(33)25(2,3)27(4)24(29)34/h8-14,19,21-22H,15H2,1-7H3,(H,26,31) |
| InChIKey | GRATZTILVTUSQG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.72 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|