C15H17IN2O2S — CID 134260107
N-[(6R)-2-iodo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]-2-phenylacetamide (PubChem CID 134260107) has the molecular formula C15H17IN2O2S and a molecular weight of 416.28 g/mol. Its IUPAC name is N-[(6R)-2-iodo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]-2-phenylacetamide.
| Compound Name | N-[(6R)-2-iodo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 134260107 |
| Molecular Formula | C15H17IN2O2S |
| Molecular Weight | 416.28 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | N-[(6R)-2-iodo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]-2-phenylacetamide |
| SMILES | CC1(C)SC2[C@H](NC(=O)Cc3ccccc3)C(=O)N2C1I |
| InChI | InChI=1S/C15H17IN2O2S/c1-15(2)14(16)18-12(20)11(13(18)21-15)17-10(19)8-9-6-4-3-5-7-9/h3-7,11,13-14H,8H2,1-2H3,(H,17,19)/t11-,13?,14?/m1/s1 |
| InChIKey | MHPGXRPZIZYUNI-LMWSTFAQSA-N |
| XLogP | 2.17 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|