C16H18N6O3S — CID 102461637
N-[(2R,5R,6R)-2-(carbonazidoylamino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]-2-phenylacetamide (PubChem CID 102461637) has the molecular formula C16H18N6O3S and a molecular weight of 374.43 g/mol. Its IUPAC name is N-[(2R,5R,6R)-2-(carbonazidoylamino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]-2-phenylacetamide.
| Compound Name | N-[(2R,5R,6R)-2-(carbonazidoylamino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 102461637 |
| Molecular Formula | C16H18N6O3S |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | N-[(2R,5R,6R)-2-(carbonazidoylamino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]-2-phenylacetamide |
| SMILES | CC1(C)S[C@@H]2[C@H](NC(=O)Cc3ccccc3)C(=O)N2[C@H]1NC(=O)N=[N+]=[N-] |
| InChI | InChI=1S/C16H18N6O3S/c1-16(2)14(19-15(25)20-21-17)22-12(24)11(13(22)26-16)18-10(23)8-9-6-4-3-5-7-9/h3-7,11,13-14H,8H2,1-2H3,(H,18,23)(H,19,25)/t11-,13-,14-/m1/s1 |
| InChIKey | NMVHXXWDYJEVSV-MRVWCRGKSA-N |
| XLogP | 1.75 |
| TPSA | 127.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|