C20H19N3O7S — CID 87889537
(4-nitrophenyl)methyl 2-hydroxy-2-[2-oxo-3-[(2-phenylacetyl)amino]-4-sulfanylazetidin-1-yl]acetate (PubChem CID 87889537) has the molecular formula C20H19N3O7S and a molecular weight of 445.45 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-hydroxy-2-[2-oxo-3-[(2-phenylacetyl)amino]-4-sulfanylazetidin-1-yl]acetate.
| Compound Name | (4-nitrophenyl)methyl 2-hydroxy-2-[2-oxo-3-[(2-phenylacetyl)amino]-4-sulfanylazetidin-1-yl]acetate |
|---|---|
| PubChem CID | 87889537 |
| Molecular Formula | C20H19N3O7S |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | (4-nitrophenyl)methyl 2-hydroxy-2-[2-oxo-3-[(2-phenylacetyl)amino]-4-sulfanylazetidin-1-yl]acetate |
| SMILES | O=C(Cc1ccccc1)NC1C(=O)N(C(O)C(=O)OCc2ccc([N+](=O)[O-])cc2)C1S |
| InChI | InChI=1S/C20H19N3O7S/c24-15(10-12-4-2-1-3-5-12)21-16-17(25)22(19(16)31)18(26)20(27)30-11-13-6-8-14(9-7-13)23(28)29/h1-9,16,18-19,26,31H,10-11H2,(H,21,24) |
| InChIKey | PKVYEHZCNPPPOD-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|