C23H21Cl2N3O6 — CID 70480307
(4-nitrophenyl)methyl 3-(chloromethyl)-2-[2-chloro-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]but-3-enoate (PubChem CID 70480307) has the molecular formula C23H21Cl2N3O6 and a molecular weight of 506.34 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 3-(chloromethyl)-2-[2-chloro-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]but-3-enoate.
| Compound Name | (4-nitrophenyl)methyl 3-(chloromethyl)-2-[2-chloro-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]but-3-enoate |
|---|---|
| PubChem CID | 70480307 |
| Molecular Formula | C23H21Cl2N3O6 |
| Molecular Weight | 506.34 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | (4-nitrophenyl)methyl 3-(chloromethyl)-2-[2-chloro-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]but-3-enoate |
| SMILES | C=C(CCl)C(C(=O)OCc1ccc([N+](=O)[O-])cc1)N1C(=O)C(NC(=O)Cc2ccccc2)C1Cl |
| InChI | InChI=1S/C23H21Cl2N3O6/c1-14(12-24)20(23(31)34-13-16-7-9-17(10-8-16)28(32)33)27-21(25)19(22(27)30)26-18(29)11-15-5-3-2-4-6-15/h2-10,19-21H,1,11-13H2,(H,26,29) |
| InChIKey | ZSNXFJRNBJFCHA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|