C29H27ClN2O6S2 — CID 13243926
benzyl 2-[2-(benzenesulfonylsulfanyl)-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-3-(chloromethyl)but-3-enoate (PubChem CID 13243926) has the molecular formula C29H27ClN2O6S2 and a molecular weight of 599.13 g/mol. Its IUPAC name is benzyl 2-[2-(benzenesulfonylsulfanyl)-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-3-(chloromethyl)but-3-enoate.
| Compound Name | benzyl 2-[2-(benzenesulfonylsulfanyl)-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-3-(chloromethyl)but-3-enoate |
|---|---|
| PubChem CID | 13243926 |
| Molecular Formula | C29H27ClN2O6S2 |
| Molecular Weight | 599.13 g/mol |
| Exact Mass | 598.10 |
| IUPAC Name | benzyl 2-[2-(benzenesulfonylsulfanyl)-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-3-(chloromethyl)but-3-enoate |
| SMILES | C=C(CCl)C(C(=O)OCc1ccccc1)N1C(=O)C(NC(=O)Cc2ccccc2)C1SS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H27ClN2O6S2/c1-20(18-30)26(29(35)38-19-22-13-7-3-8-14-22)32-27(34)25(31-24(33)17-21-11-5-2-6-12-21)28(32)39-40(36,37)23-15-9-4-10-16-23/h2-16,25-26,28H,1,17-19H2,(H,31,33) |
| InChIKey | NDJXSPYESKRKGF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.13 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|