C15H17ClHgN2O3S — CID 70520874
[3-amino-1-(3-methyl-1-oxo-1-phenylmethoxybut-3-en-2-yl)-4-oxoazetidin-2-yl]sulfanyl-chloromercury (PubChem CID 70520874) has the molecular formula C15H17ClHgN2O3S and a molecular weight of 541.42 g/mol. Its IUPAC name is [3-amino-1-(3-methyl-1-oxo-1-phenylmethoxybut-3-en-2-yl)-4-oxoazetidin-2-yl]sulfanyl-chloromercury.
| Compound Name | [3-amino-1-(3-methyl-1-oxo-1-phenylmethoxybut-3-en-2-yl)-4-oxoazetidin-2-yl]sulfanyl-chloromercury |
|---|---|
| PubChem CID | 70520874 |
| Molecular Formula | C15H17ClHgN2O3S |
| Molecular Weight | 541.42 g/mol |
| Exact Mass | 542.04 |
| IUPAC Name | [3-amino-1-(3-methyl-1-oxo-1-phenylmethoxybut-3-en-2-yl)-4-oxoazetidin-2-yl]sulfanyl-chloromercury |
| SMILES | C=C(C)C(C(=O)OCc1ccccc1)N1C(=O)C(N)C1S[Hg]Cl |
| InChI | InChI=1S/C15H18N2O3S.ClH.Hg/c1-9(2)12(17-13(18)11(16)14(17)21)15(19)20-8-10-6-4-3-5-7-10;;/h3-7,11-12,14,21H,1,8,16H2,2H3;1H;/q;;+2/p-2 |
| InChIKey | AXXYJKZTRDZWFL-UHFFFAOYSA-L |
| XLogP | 2.05 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|