C29H26F2N2O6S2 — CID 139603791
(4-methoxyphenyl)methyl 2-[2-(benzenesulfonylsulfanyl)-3-[(3,5-difluorophenyl)methylideneamino]-4-oxoazetidin-1-yl]-3-methylbut-3-enoate (PubChem CID 139603791) has the molecular formula C29H26F2N2O6S2 and a molecular weight of 600.67 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 2-[2-(benzenesulfonylsulfanyl)-3-[(3,5-difluorophenyl)methylideneamino]-4-oxoazetidin-1-yl]-3-methylbut-3-enoate.
| Compound Name | (4-methoxyphenyl)methyl 2-[2-(benzenesulfonylsulfanyl)-3-[(3,5-difluorophenyl)methylideneamino]-4-oxoazetidin-1-yl]-3-methylbut-3-enoate |
|---|---|
| PubChem CID | 139603791 |
| Molecular Formula | C29H26F2N2O6S2 |
| Molecular Weight | 600.67 g/mol |
| Exact Mass | 600.12 |
| IUPAC Name | (4-methoxyphenyl)methyl 2-[2-(benzenesulfonylsulfanyl)-3-[(3,5-difluorophenyl)methylideneamino]-4-oxoazetidin-1-yl]-3-methylbut-3-enoate |
| SMILES | C=C(C)C(C(=O)OCc1ccc(OC)cc1)N1C(=O)C(/N=C/c2cc(F)cc(F)c2)C1SS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H26F2N2O6S2/c1-18(2)26(29(35)39-17-19-9-11-23(38-3)12-10-19)33-27(34)25(32-16-20-13-21(30)15-22(31)14-20)28(33)40-41(36,37)24-7-5-4-6-8-24/h4-16,25-26,28H,1,17H2,2-3H3/b32-16+ |
| InChIKey | CARDUYRUDRUKOV-KPGMTVGESA-N |
| XLogP | 4.74 |
| TPSA | 102.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.67 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|