C19H20ClN3O6S — CID 88774597
(4-methoxyphenyl)methyl 2-[3-[acetyl(cyano)amino]-2-chlorosulfinyl-4-oxoazetidin-1-yl]-3-methylbut-3-enoate (PubChem CID 88774597) has the molecular formula C19H20ClN3O6S and a molecular weight of 453.90 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 2-[3-[acetyl(cyano)amino]-2-chlorosulfinyl-4-oxoazetidin-1-yl]-3-methylbut-3-enoate.
| Compound Name | (4-methoxyphenyl)methyl 2-[3-[acetyl(cyano)amino]-2-chlorosulfinyl-4-oxoazetidin-1-yl]-3-methylbut-3-enoate |
|---|---|
| PubChem CID | 88774597 |
| Molecular Formula | C19H20ClN3O6S |
| Molecular Weight | 453.90 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | (4-methoxyphenyl)methyl 2-[3-[acetyl(cyano)amino]-2-chlorosulfinyl-4-oxoazetidin-1-yl]-3-methylbut-3-enoate |
| SMILES | C=C(C)C(C(=O)OCc1ccc(OC)cc1)N1C(=O)C(N(C#N)C(C)=O)C1S(=O)Cl |
| InChI | InChI=1S/C19H20ClN3O6S/c1-11(2)15(19(26)29-9-13-5-7-14(28-4)8-6-13)23-17(25)16(18(23)30(20)27)22(10-21)12(3)24/h5-8,15-16,18H,1,9H2,2-4H3 |
| InChIKey | YQIBWFUROBUCQX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 117.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.90 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|