C19H22N2O7 — CID 13430183
methyl (2R)-2-[(2S,3S)-2-acetyloxy-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-1-yl]-3-methylbut-3-enoate (PubChem CID 13430183) has the molecular formula C19H22N2O7 and a molecular weight of 390.39 g/mol. Its IUPAC name is methyl (2R)-2-[(2S,3S)-2-acetyloxy-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-1-yl]-3-methylbut-3-enoate.
| Compound Name | methyl (2R)-2-[(2S,3S)-2-acetyloxy-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-1-yl]-3-methylbut-3-enoate |
|---|---|
| PubChem CID | 13430183 |
| Molecular Formula | C19H22N2O7 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | methyl (2R)-2-[(2S,3S)-2-acetyloxy-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-1-yl]-3-methylbut-3-enoate |
| SMILES | C=C(C)[C@H](C(=O)OC)N1C(=O)[C@@H](NC(=O)OCc2ccccc2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H22N2O7/c1-11(2)15(18(24)26-4)21-16(23)14(17(21)28-12(3)22)20-19(25)27-10-13-8-6-5-7-9-13/h5-9,14-15,17H,1,10H2,2-4H3,(H,20,25)/t14-,15-,17+/m1/s1 |
| InChIKey | JAPYBBZNOQYBJX-INMHGKMJSA-N |
| XLogP | 1.13 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|