C30H30N4O7S — CID 67593930
(4-nitrophenyl)methyl 2-[(2R,3R)-2-benzylsulfinamoyl-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-3-methylbut-3-enoate (PubChem CID 67593930) has the molecular formula C30H30N4O7S and a molecular weight of 590.66 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[(2R,3R)-2-benzylsulfinamoyl-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-3-methylbut-3-enoate.
| Compound Name | (4-nitrophenyl)methyl 2-[(2R,3R)-2-benzylsulfinamoyl-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-3-methylbut-3-enoate |
|---|---|
| PubChem CID | 67593930 |
| Molecular Formula | C30H30N4O7S |
| Molecular Weight | 590.66 g/mol |
| Exact Mass | 590.18 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[(2R,3R)-2-benzylsulfinamoyl-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-3-methylbut-3-enoate |
| SMILES | C=C(C)C(C(=O)OCc1ccc([N+](=O)[O-])cc1)N1C(=O)[C@@H](NC(=O)Cc2ccccc2)[C@H]1S(=O)NCc1ccccc1 |
| InChI | InChI=1S/C30H30N4O7S/c1-20(2)27(30(37)41-19-23-13-15-24(16-14-23)34(38)39)33-28(36)26(32-25(35)17-21-9-5-3-6-10-21)29(33)42(40)31-18-22-11-7-4-8-12-22/h3-16,26-27,29,31H,1,17-19H2,2H3,(H,32,35)/t26-,27?,29-,42?/m1/s1 |
| InChIKey | SWTVFVDKDSMRNM-ARHRLBAASA-N |
| XLogP | 2.93 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.66 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|