C23H22IN3O7 — CID 20512650
(4-nitrophenyl)methyl 2-(3-acetamido-2-iodo-4-oxoazetidin-1-yl)-3-methylbut-3-enoate;6-oxabicyclo[3.1.1]hepta-1(7),2,4-triene (PubChem CID 20512650) has the molecular formula C23H22IN3O7 and a molecular weight of 579.35 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-(3-acetamido-2-iodo-4-oxoazetidin-1-yl)-3-methylbut-3-enoate;6-oxabicyclo[3.1.1]hepta-1(7),2,4-triene.
| Compound Name | (4-nitrophenyl)methyl 2-(3-acetamido-2-iodo-4-oxoazetidin-1-yl)-3-methylbut-3-enoate;6-oxabicyclo[3.1.1]hepta-1(7),2,4-triene |
|---|---|
| PubChem CID | 20512650 |
| Molecular Formula | C23H22IN3O7 |
| Molecular Weight | 579.35 g/mol |
| Exact Mass | 579.05 |
| IUPAC Name | (4-nitrophenyl)methyl 2-(3-acetamido-2-iodo-4-oxoazetidin-1-yl)-3-methylbut-3-enoate;6-oxabicyclo[3.1.1]hepta-1(7),2,4-triene |
| SMILES | C=C(C)C(C(=O)OCc1ccc([N+](=O)[O-])cc1)N1C(=O)C(NC(C)=O)C1I.c1cc2cc(c1)O2 |
| InChI | InChI=1S/C17H18IN3O6.C6H4O/c1-9(2)14(20-15(18)13(16(20)23)19-10(3)22)17(24)27-8-11-4-6-12(7-5-11)21(25)26;1-2-5-4-6(3-1)7-5/h4-7,13-15H,1,8H2,2-3H3,(H,19,22);1-4H |
| InChIKey | GOZGNILFALMIDL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|