C22H20BrN3O8S — CID 173423445
(4-nitrophenyl)methyl 2-(3-acetamido-2-oxo-4-sulfanylazetidin-1-yl)-4-bromo-3-hydroxybut-2-enoate;6-oxabicyclo[3.1.1]hepta-1(7),2,4-triene (PubChem CID 173423445) has the molecular formula C22H20BrN3O8S and a molecular weight of 566.39 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-(3-acetamido-2-oxo-4-sulfanylazetidin-1-yl)-4-bromo-3-hydroxybut-2-enoate;6-oxabicyclo[3.1.1]hepta-1(7),2,4-triene.
| Compound Name | (4-nitrophenyl)methyl 2-(3-acetamido-2-oxo-4-sulfanylazetidin-1-yl)-4-bromo-3-hydroxybut-2-enoate;6-oxabicyclo[3.1.1]hepta-1(7),2,4-triene |
|---|---|
| PubChem CID | 173423445 |
| Molecular Formula | C22H20BrN3O8S |
| Molecular Weight | 566.39 g/mol |
| Exact Mass | 565.02 |
| IUPAC Name | (4-nitrophenyl)methyl 2-(3-acetamido-2-oxo-4-sulfanylazetidin-1-yl)-4-bromo-3-hydroxybut-2-enoate;6-oxabicyclo[3.1.1]hepta-1(7),2,4-triene |
| SMILES | CC(=O)NC1C(=O)N(C(C(=O)OCc2ccc([N+](=O)[O-])cc2)=C(O)CBr)C1S.c1cc2cc(c1)O2 |
| InChI | InChI=1S/C16H16BrN3O7S.C6H4O/c1-8(21)18-12-14(23)19(15(12)28)13(11(22)6-17)16(24)27-7-9-2-4-10(5-3-9)20(25)26;1-2-5-4-6(3-1)7-5/h2-5,12,15,22,28H,6-7H2,1H3,(H,18,21);1-4H |
| InChIKey | QHPKQMFJWWLPTI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|