C11H13Cl3N2O5S — CID 173423408
2,2,2-trichloroethyl 2-(3-acetamido-2-oxo-4-sulfanylazetidin-1-yl)-3-hydroxybut-2-enoate (PubChem CID 173423408) has the molecular formula C11H13Cl3N2O5S and a molecular weight of 391.66 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 2-(3-acetamido-2-oxo-4-sulfanylazetidin-1-yl)-3-hydroxybut-2-enoate.
| Compound Name | 2,2,2-trichloroethyl 2-(3-acetamido-2-oxo-4-sulfanylazetidin-1-yl)-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 173423408 |
| Molecular Formula | C11H13Cl3N2O5S |
| Molecular Weight | 391.66 g/mol |
| Exact Mass | 389.96 |
| IUPAC Name | 2,2,2-trichloroethyl 2-(3-acetamido-2-oxo-4-sulfanylazetidin-1-yl)-3-hydroxybut-2-enoate |
| SMILES | CC(=O)NC1C(=O)N(C(C(=O)OCC(Cl)(Cl)Cl)=C(C)O)C1S |
| InChI | InChI=1S/C11H13Cl3N2O5S/c1-4(17)7(10(20)21-3-11(12,13)14)16-8(19)6(9(16)22)15-5(2)18/h6,9,17,22H,3H2,1-2H3,(H,15,18) |
| InChIKey | PXWPYYNQKIAOMG-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.66 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|