C11H11Cl3N2O5S — CID 70513608
2,2,2-trichloroethyl (6S)-7-acetamido-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 70513608) has the molecular formula C11H11Cl3N2O5S and a molecular weight of 389.64 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (6S)-7-acetamido-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (6S)-7-acetamido-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70513608 |
| Molecular Formula | C11H11Cl3N2O5S |
| Molecular Weight | 389.64 g/mol |
| Exact Mass | 387.95 |
| IUPAC Name | 2,2,2-trichloroethyl (6S)-7-acetamido-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)NC1C(=O)N2C(C(=O)OCC(Cl)(Cl)Cl)=C(O)CS[C@@H]12 |
| InChI | InChI=1S/C11H11Cl3N2O5S/c1-4(17)15-6-8(19)16-7(5(18)2-22-9(6)16)10(20)21-3-11(12,13)14/h6,9,18H,2-3H2,1H3,(H,15,17)/t6?,9-/m0/s1 |
| InChIKey | UABNQYKMUBBTQE-HSOSERFQSA-N |
| XLogP | 1.09 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.64 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|