C20H18Cl3N3O9S — CID 70634580
2,2,2-trichloroethyl (6R)-3-(acetyloxymethyl)-7-[(4-nitrophenyl)methoxycarbonylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 70634580) has the molecular formula C20H18Cl3N3O9S and a molecular weight of 582.80 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (6R)-3-(acetyloxymethyl)-7-[(4-nitrophenyl)methoxycarbonylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (6R)-3-(acetyloxymethyl)-7-[(4-nitrophenyl)methoxycarbonylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70634580 |
| Molecular Formula | C20H18Cl3N3O9S |
| Molecular Weight | 582.80 g/mol |
| Exact Mass | 580.98 |
| IUPAC Name | 2,2,2-trichloroethyl (6R)-3-(acetyloxymethyl)-7-[(4-nitrophenyl)methoxycarbonylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)OCC1=C(C(=O)OCC(Cl)(Cl)Cl)N2C(=O)C(NC(=O)OCc3ccc([N+](=O)[O-])cc3)[C@H]2SC1 |
| InChI | InChI=1S/C20H18Cl3N3O9S/c1-10(27)33-7-12-8-36-17-14(16(28)25(17)15(12)18(29)35-9-20(21,22)23)24-19(30)34-6-11-2-4-13(5-3-11)26(31)32/h2-5,14,17H,6-9H2,1H3,(H,24,30)/t14?,17-/m1/s1 |
| InChIKey | LFCWAYQZPQDPLL-FBMWCMRBSA-N |
| XLogP | 2.84 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.80 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|