C16H17N3O6S — CID 170454265
2-[(3R,4R)-3-[[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino]-2-oxo-4-sulfanylazetidin-1-yl]-3-methyl-4-oxobut-2-enoic acid (PubChem CID 170454265) has the molecular formula C16H17N3O6S and a molecular weight of 379.39 g/mol. Its IUPAC name is 2-[(3R,4R)-3-[[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino]-2-oxo-4-sulfanylazetidin-1-yl]-3-methyl-4-oxobut-2-enoic acid.
| Compound Name | 2-[(3R,4R)-3-[[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino]-2-oxo-4-sulfanylazetidin-1-yl]-3-methyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 170454265 |
| Molecular Formula | C16H17N3O6S |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 2-[(3R,4R)-3-[[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino]-2-oxo-4-sulfanylazetidin-1-yl]-3-methyl-4-oxobut-2-enoic acid |
| SMILES | CC(C=O)=C(C(=O)O)N1C(=O)[C@@H](NC(=O)[C@H](N)c2ccc(O)cc2)[C@H]1S |
| InChI | InChI=1S/C16H17N3O6S/c1-7(6-20)12(16(24)25)19-14(23)11(15(19)26)18-13(22)10(17)8-2-4-9(21)5-3-8/h2-6,10-11,15,21,26H,17H2,1H3,(H,18,22)(H,24,25)/t10-,11-,15-/m1/s1 |
| InChIKey | BSEJJVWBJQLNQH-UEKVPHQBSA-N |
| XLogP | -0.47 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|