C18H19N3O6S — CID 170454535
(4E)-2-[3-[[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino]-2,4-dioxoazetidin-1-yl]-3-(sulfanylmethyl)hexa-2,4-dienoic acid (PubChem CID 170454535) has the molecular formula C18H19N3O6S and a molecular weight of 405.43 g/mol. Its IUPAC name is (4E)-2-[3-[[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino]-2,4-dioxoazetidin-1-yl]-3-(sulfanylmethyl)hexa-2,4-dienoic acid.
| Compound Name | (4E)-2-[3-[[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino]-2,4-dioxoazetidin-1-yl]-3-(sulfanylmethyl)hexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 170454535 |
| Molecular Formula | C18H19N3O6S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | (4E)-2-[3-[[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino]-2,4-dioxoazetidin-1-yl]-3-(sulfanylmethyl)hexa-2,4-dienoic acid |
| SMILES | C/C=C/C(CS)=C(C(=O)O)N1C(=O)C(NC(=O)[C@H](N)c2ccc(O)cc2)C1=O |
| InChI | InChI=1S/C18H19N3O6S/c1-2-3-10(8-28)14(18(26)27)21-16(24)13(17(21)25)20-15(23)12(19)9-4-6-11(22)7-5-9/h2-7,12-13,22,28H,8,19H2,1H3,(H,20,23)(H,26,27)/b3-2+,14-10?/t12-/m1/s1 |
| InChIKey | FKJRXIVKGFVRHG-LPKWZPHFSA-N |
| XLogP | 0.09 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|