C15H14ClN3O5S — CID 170454264
2-[3-[[(2R)-2-amino-2-phenylacetyl]amino]-2,4-dioxoazetidin-1-yl]-3-chloro-4-sulfanylbut-2-enoic acid (PubChem CID 170454264) has the molecular formula C15H14ClN3O5S and a molecular weight of 383.81 g/mol. Its IUPAC name is 2-[3-[[(2R)-2-amino-2-phenylacetyl]amino]-2,4-dioxoazetidin-1-yl]-3-chloro-4-sulfanylbut-2-enoic acid.
| Compound Name | 2-[3-[[(2R)-2-amino-2-phenylacetyl]amino]-2,4-dioxoazetidin-1-yl]-3-chloro-4-sulfanylbut-2-enoic acid |
|---|---|
| PubChem CID | 170454264 |
| Molecular Formula | C15H14ClN3O5S |
| Molecular Weight | 383.81 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | 2-[3-[[(2R)-2-amino-2-phenylacetyl]amino]-2,4-dioxoazetidin-1-yl]-3-chloro-4-sulfanylbut-2-enoic acid |
| SMILES | N[C@@H](C(=O)NC1C(=O)N(C(C(=O)O)=C(Cl)CS)C1=O)c1ccccc1 |
| InChI | InChI=1S/C15H14ClN3O5S/c16-8(6-25)11(15(23)24)19-13(21)10(14(19)22)18-12(20)9(17)7-4-2-1-3-5-7/h1-5,9-10,25H,6,17H2,(H,18,20)(H,23,24)/t9-/m1/s1 |
| InChIKey | BRZWWEAKIWIZCH-SECBINFHSA-N |
| XLogP | 0.00 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.81 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|