C12H13Cl3N2O5S — CID 22797986
2,2,2-trichloroethyl (6S)-7-acetamido-3-methylidene-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate (PubChem CID 22797986) has the molecular formula C12H13Cl3N2O5S and a molecular weight of 403.67 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (6S)-7-acetamido-3-methylidene-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (6S)-7-acetamido-3-methylidene-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
|---|---|
| PubChem CID | 22797986 |
| Molecular Formula | C12H13Cl3N2O5S |
| Molecular Weight | 403.67 g/mol |
| Exact Mass | 401.96 |
| IUPAC Name | 2,2,2-trichloroethyl (6S)-7-acetamido-3-methylidene-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
| SMILES | C=C1CS(=O)[C@H]2C(NC(C)=O)C(=O)N2C1C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H13Cl3N2O5S/c1-5-3-23(21)10-7(16-6(2)18)9(19)17(10)8(5)11(20)22-4-12(13,14)15/h7-8,10H,1,3-4H2,2H3,(H,16,18)/t7?,8?,10-,23?/m0/s1 |
| InChIKey | JSUYCRZBCDKOOZ-JELJEECRSA-N |
| XLogP | 0.26 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.67 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|