C23H28Cl3N3O7S — CID 70610246
2,2,2-trichloroethyl (5R)-3,3-dimethyl-6-[[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]acetyl]amino]-4,7-dioxo-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70610246) has the molecular formula C23H28Cl3N3O7S and a molecular weight of 596.92 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (5R)-3,3-dimethyl-6-[[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]acetyl]amino]-4,7-dioxo-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (5R)-3,3-dimethyl-6-[[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]acetyl]amino]-4,7-dioxo-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70610246 |
| Molecular Formula | C23H28Cl3N3O7S |
| Molecular Weight | 596.92 g/mol |
| Exact Mass | 595.07 |
| IUPAC Name | 2,2,2-trichloroethyl (5R)-3,3-dimethyl-6-[[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]acetyl]amino]-4,7-dioxo-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)Nc1ccccc1CC(=O)NC1C(=O)N2C(C(=O)OCC(Cl)(Cl)Cl)C(C)(C)S(=O)[C@H]12 |
| InChI | InChI=1S/C23H28Cl3N3O7S/c1-21(2,3)36-20(33)27-13-9-7-6-8-12(13)10-14(30)28-15-17(31)29-16(19(32)35-11-23(24,25)26)22(4,5)37(34)18(15)29/h6-9,15-16,18H,10-11H2,1-5H3,(H,27,33)(H,28,30)/t15?,16?,18-,37?/m1/s1 |
| InChIKey | HFWLMGQZEGCHFZ-ZWRDXIASSA-N |
| XLogP | 3.05 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.92 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|