C18H30ClN3O3 — CID 175581046
tert-butyl N-[2-(2-hydrazinyl-2-oxoethyl)phenyl]carbamate;1-chloropentane (PubChem CID 175581046) has the molecular formula C18H30ClN3O3 and a molecular weight of 371.91 g/mol. Its IUPAC name is tert-butyl N-[2-(2-hydrazinyl-2-oxoethyl)phenyl]carbamate;1-chloropentane.
| Compound Name | tert-butyl N-[2-(2-hydrazinyl-2-oxoethyl)phenyl]carbamate;1-chloropentane |
|---|---|
| PubChem CID | 175581046 |
| Molecular Formula | C18H30ClN3O3 |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | tert-butyl N-[2-(2-hydrazinyl-2-oxoethyl)phenyl]carbamate;1-chloropentane |
| SMILES | CC(C)(C)OC(=O)Nc1ccccc1CC(=O)NN.CCCCCCl |
| InChI | InChI=1S/C13H19N3O3.C5H11Cl/c1-13(2,3)19-12(18)15-10-7-5-4-6-9(10)8-11(17)16-14;1-2-3-4-5-6/h4-7H,8,14H2,1-3H3,(H,15,18)(H,16,17);2-5H2,1H3 |
| InChIKey | BQICSWIWUBSCSN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|