C19H27NO5 — CID 58119937
8-[2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-7-oxooctanoic acid (PubChem CID 58119937) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is 8-[2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-7-oxooctanoic acid.
| Compound Name | 8-[2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-7-oxooctanoic acid |
|---|---|
| PubChem CID | 58119937 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 8-[2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-7-oxooctanoic acid |
| SMILES | CC(C)(C)OC(=O)Nc1ccccc1CC(=O)CCCCCC(=O)O |
| InChI | InChI=1S/C19H27NO5/c1-19(2,3)25-18(24)20-16-11-8-7-9-14(16)13-15(21)10-5-4-6-12-17(22)23/h7-9,11H,4-6,10,12-13H2,1-3H3,(H,20,24)(H,22,23) |
| InChIKey | IJAOZEOGMXXWIC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|